C15H19ClFN — CID 114013906
1-[3-[(4-chloro-3-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]-N-methylmethanamine (PubChem CID 114013906) has the molecular formula C15H19ClFN and a molecular weight of 267.77 g/mol. Its IUPAC name is 1-[3-[(4-chloro-3-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]-N-methylmethanamine.
| Compound Name | 1-[3-[(4-chloro-3-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114013906 |
| Molecular Formula | C15H19ClFN |
| Molecular Weight | 267.77 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[3-[(4-chloro-3-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]-N-methylmethanamine |
| SMILES | CNCC1(Cc2ccc(Cl)c(F)c2)CC2CC2C1 |
| InChI | InChI=1S/C15H19ClFN/c1-18-9-15(7-11-5-12(11)8-15)6-10-2-3-13(16)14(17)4-10/h2-4,11-12,18H,5-9H2,1H3 |
| InChIKey | CRIMANJYYJRAPH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |