C16H24ClFN2 — CID 102620665
5-tert-butyl-1-[(2-chloro-5-fluorophenyl)methyl]-2-methylpiperazine (PubChem CID 102620665) has the molecular formula C16H24ClFN2 and a molecular weight of 298.83 g/mol. Its IUPAC name is 5-tert-butyl-1-[(2-chloro-5-fluorophenyl)methyl]-2-methylpiperazine.
| Compound Name | 5-tert-butyl-1-[(2-chloro-5-fluorophenyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 102620665 |
| Molecular Formula | C16H24ClFN2 |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-tert-butyl-1-[(2-chloro-5-fluorophenyl)methyl]-2-methylpiperazine |
| SMILES | CC1CNC(C(C)(C)C)CN1Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C16H24ClFN2/c1-11-8-19-15(16(2,3)4)10-20(11)9-12-7-13(18)5-6-14(12)17/h5-7,11,15,19H,8-10H2,1-4H3 |
| InChIKey | GPSNAOLHOHZPIY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |