C13H18O5S — CID 102620688
(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl methanesulfonate (PubChem CID 102620688) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is (5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl methanesulfonate.
| Compound Name | (5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 102620688 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl methanesulfonate |
| SMILES | CCOc1cc2c(cc1COS(C)(=O)=O)OC(C)C2 |
| InChI | InChI=1S/C13H18O5S/c1-4-16-12-6-10-5-9(2)18-13(10)7-11(12)8-17-19(3,14)15/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | CONATEWVJYJADG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|