C12H16O6S — CID 103574423
(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-hydroxymethanesulfonic acid (PubChem CID 103574423) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is (5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-hydroxymethanesulfonic acid.
| Compound Name | (5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-hydroxymethanesulfonic acid |
|---|---|
| PubChem CID | 103574423 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-hydroxymethanesulfonic acid |
| SMILES | CCOc1cc2c(cc1C(O)S(=O)(=O)O)OC(C)C2 |
| InChI | InChI=1S/C12H16O6S/c1-3-17-11-5-8-4-7(2)18-10(8)6-9(11)12(13)19(14,15)16/h5-7,12-13H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | AUBLOIDXCWWSLQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|