C13H16Br2ClF — CID 102621604
2-[2,2-bis(bromomethyl)pentyl]-1-chloro-4-fluorobenzene (PubChem CID 102621604) has the molecular formula C13H16Br2ClF and a molecular weight of 386.53 g/mol. Its IUPAC name is 2-[2,2-bis(bromomethyl)pentyl]-1-chloro-4-fluorobenzene.
| Compound Name | 2-[2,2-bis(bromomethyl)pentyl]-1-chloro-4-fluorobenzene |
|---|---|
| PubChem CID | 102621604 |
| Molecular Formula | C13H16Br2ClF |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 2-[2,2-bis(bromomethyl)pentyl]-1-chloro-4-fluorobenzene |
| SMILES | CCCC(CBr)(CBr)Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H16Br2ClF/c1-2-5-13(8-14,9-15)7-10-6-11(17)3-4-12(10)16/h3-4,6H,2,5,7-9H2,1H3 |
| InChIKey | BPXOUWFTAQHYOQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|