C13H16Br2Cl2 — CID 79453631
2-[2,2-bis(bromomethyl)pentyl]-1,3-dichlorobenzene (PubChem CID 79453631) has the molecular formula C13H16Br2Cl2 and a molecular weight of 402.99 g/mol. Its IUPAC name is 2-[2,2-bis(bromomethyl)pentyl]-1,3-dichlorobenzene.
| Compound Name | 2-[2,2-bis(bromomethyl)pentyl]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 79453631 |
| Molecular Formula | C13H16Br2Cl2 |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 399.90 |
| IUPAC Name | 2-[2,2-bis(bromomethyl)pentyl]-1,3-dichlorobenzene |
| SMILES | CCCC(CBr)(CBr)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Br2Cl2/c1-2-6-13(8-14,9-15)7-10-11(16)4-3-5-12(10)17/h3-5H,2,6-9H2,1H3 |
| InChIKey | GIXOHSMODCNNRO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|