C15H21BrCl2S — CID 65006092
2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-1,4-dichlorobenzene (PubChem CID 65006092) has the molecular formula C15H21BrCl2S and a molecular weight of 384.21 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-1,4-dichlorobenzene.
| Compound Name | 2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-1,4-dichlorobenzene |
|---|---|
| PubChem CID | 65006092 |
| Molecular Formula | C15H21BrCl2S |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-1,4-dichlorobenzene |
| SMILES | CCCC(CBr)(CCC)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H21BrCl2S/c1-3-7-15(10-16,8-4-2)11-19-14-9-12(17)5-6-13(14)18/h5-6,9H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | ZLYUEIJAMSUDMR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|