C11H14Cl2OS — CID 114496192
1-(2,5-dichlorophenyl)sulfanyl-2-methylbutan-2-ol (PubChem CID 114496192) has the molecular formula C11H14Cl2OS and a molecular weight of 265.20 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfanyl-2-methylbutan-2-ol.
| Compound Name | 1-(2,5-dichlorophenyl)sulfanyl-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 114496192 |
| Molecular Formula | C11H14Cl2OS |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfanyl-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2OS/c1-3-11(2,14)7-15-10-6-8(12)4-5-9(10)13/h4-6,14H,3,7H2,1-2H3 |
| InChIKey | ZERWVDRFRDEEDR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |