C13H16Cl2N2O2S — CID 5155672
N-(tert-butylcarbamoyl)-2-(2,5-dichlorophenyl)sulfanylacetamide (PubChem CID 5155672) has the molecular formula C13H16Cl2N2O2S and a molecular weight of 335.26 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-(2,5-dichlorophenyl)sulfanylacetamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-(2,5-dichlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 5155672 |
| Molecular Formula | C13H16Cl2N2O2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-(2,5-dichlorophenyl)sulfanylacetamide |
| SMILES | CC(C)(C)NC(=O)NC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2S/c1-13(2,3)17-12(19)16-11(18)7-20-10-6-8(14)4-5-9(10)15/h4-6H,7H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | ZAGZFPTWODSSLF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |