C16H26BrNS — CID 102924463
2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-4,6-dimethylpyridine (PubChem CID 102924463) has the molecular formula C16H26BrNS and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-4,6-dimethylpyridine.
| Compound Name | 2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 102924463 |
| Molecular Formula | C16H26BrNS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[2-(bromomethyl)-2-propylpentyl]sulfanyl-4,6-dimethylpyridine |
| SMILES | CCCC(CBr)(CCC)CSc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C16H26BrNS/c1-5-7-16(11-17,8-6-2)12-19-15-10-13(3)9-14(4)18-15/h9-10H,5-8,11-12H2,1-4H3 |
| InChIKey | SISYSWIEKOJCLK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|