About 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol
2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol (PubChem CID 102926682) has the molecular formula C15H24N2OS
and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol |
| PubChem CID | 102926682 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol |
| SMILES | CCNC(CO)(CSc1cc(C)cc(C)n1)C1CC1 |
| InChI | InChI=1S/C15H24N2OS/c1-4-16-15(9-18,13-5-6-13)10-19-14-8-11(2)7-12(3)17-14/h7-8,13,16,18H,4-6,9-10H2,1-3H3 |
| InChIKey | IDSKYDRONAXYOL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol?
The IUPAC name of 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol (CID 102926682) is 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol.
What is the SMILES notation for 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol?
The canonical SMILES for 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol is CCNC(CO)(CSc1cc(C)cc(C)n1)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol?
The InChIKey is IDSKYDRONAXYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2OS/c1-4-16-15(9-18,13-5-6-13)10-19-14-8-11(2)7-12(3)17-14/h7-8,13,16,18H,4-6,9-10H2,1-3H3.
What are the key properties of 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol?
2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol has a molecular weight of 280.44 g/mol, XLogP of 2.54, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-(ethylamino)propan-1-ol is sourced from PubChem (CID 102926682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).