About 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid
2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid (PubChem CID 102925740) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid |
| PubChem CID | 102925740 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid |
| SMILES | Cc1cc(C)nc(SCC(N)(C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-8-12(2)18-14(9-11)21-10-16(17,15(19)20)13-6-4-3-5-7-13/h3-9H,10,17H2,1-2H3,(H,19,20) |
| InChIKey | AXRMIQMYCNVICS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid?
The IUPAC name of 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid (CID 102925740) is 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid.
What is the SMILES notation for 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid?
The canonical SMILES for 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid is Cc1cc(C)nc(SCC(N)(C(=O)O)c2ccccc2)c1.
What is the InChIKey of 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid?
The InChIKey is AXRMIQMYCNVICS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c1-11-8-12(2)18-14(9-11)21-10-16(17,15(19)20)13-6-4-3-5-7-13/h3-9H,10,17H2,1-2H3,(H,19,20).
What are the key properties of 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid?
2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid has a molecular weight of 302.40 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropanoic acid is sourced from PubChem (CID 102925740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).