About 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol
1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol (PubChem CID 102926742) has the molecular formula C16H20N2OS
and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol |
| PubChem CID | 102926742 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol |
| SMILES | Cc1cc(C)nc(SCC(O)(CN)c2ccccc2)c1 |
| InChI | InChI=1S/C16H20N2OS/c1-12-8-13(2)18-15(9-12)20-11-16(19,10-17)14-6-4-3-5-7-14/h3-9,19H,10-11,17H2,1-2H3 |
| InChIKey | VNTWCJUEASRQCA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol?
The IUPAC name of 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol (CID 102926742) is 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol.
What is the SMILES notation for 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol?
The canonical SMILES for 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol is Cc1cc(C)nc(SCC(O)(CN)c2ccccc2)c1.
What is the InChIKey of 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol?
The InChIKey is VNTWCJUEASRQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS/c1-12-8-13(2)18-15(9-12)20-11-16(19,10-17)14-6-4-3-5-7-14/h3-9,19H,10-11,17H2,1-2H3.
What are the key properties of 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol?
1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol has a molecular weight of 288.42 g/mol, XLogP of 2.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-phenylpropan-2-ol is sourced from PubChem (CID 102926742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).