About 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol
1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol (PubChem CID 65040775) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol.
Molecular Properties
| Compound Name | 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol |
| PubChem CID | 65040775 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol |
| SMILES | Cc1nc(SCC(O)(CN)c2ccccc2)nc(C)c1C |
| InChI | InChI=1S/C16H21N3OS/c1-11-12(2)18-15(19-13(11)3)21-10-16(20,9-17)14-7-5-4-6-8-14/h4-8,20H,9-10,17H2,1-3H3 |
| InChIKey | GJIALADIQZRWGT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol?
The IUPAC name of 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol (CID 65040775) is 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol.
What is the SMILES notation for 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol?
The canonical SMILES for 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol is Cc1nc(SCC(O)(CN)c2ccccc2)nc(C)c1C.
What is the InChIKey of 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol?
The InChIKey is GJIALADIQZRWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS/c1-11-12(2)18-15(19-13(11)3)21-10-16(20,9-17)14-7-5-4-6-8-14/h4-8,20H,9-10,17H2,1-3H3.
What are the key properties of 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol?
1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol has a molecular weight of 303.43 g/mol, XLogP of 2.34, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-phenyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-2-ol is sourced from PubChem (CID 65040775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).