C16H23N3O — CID 116695981
1-amino-2-phenyl-4-(3,4,5-trimethylpyrazol-1-yl)butan-2-ol (PubChem CID 116695981) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-amino-2-phenyl-4-(3,4,5-trimethylpyrazol-1-yl)butan-2-ol.
| Compound Name | 1-amino-2-phenyl-4-(3,4,5-trimethylpyrazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 116695981 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-amino-2-phenyl-4-(3,4,5-trimethylpyrazol-1-yl)butan-2-ol |
| SMILES | Cc1nn(CCC(O)(CN)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C16H23N3O/c1-12-13(2)18-19(14(12)3)10-9-16(20,11-17)15-7-5-4-6-8-15/h4-8,20H,9-11,17H2,1-3H3 |
| InChIKey | GRSBMNUSTSFBJQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |