C15H20ClN3O — CID 116695331
2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-phenylbutan-1-ol (PubChem CID 116695331) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-phenylbutan-1-ol.
| Compound Name | 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 116695331 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-phenylbutan-1-ol |
| SMILES | Cc1nn(CCC(N)(CO)c2ccccc2)c(C)c1Cl |
| InChI | InChI=1S/C15H20ClN3O/c1-11-14(16)12(2)19(18-11)9-8-15(17,10-20)13-6-4-3-5-7-13/h3-7,20H,8-10,17H2,1-2H3 |
| InChIKey | OZZYYZJGTLLTHH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |