C12H21N3S — CID 65248708
2,2-dimethyl-4-(3,4,5-trimethylpyrazol-1-yl)butanethioamide (PubChem CID 65248708) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3,4,5-trimethylpyrazol-1-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(3,4,5-trimethylpyrazol-1-yl)butanethioamide |
|---|---|
| PubChem CID | 65248708 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2,2-dimethyl-4-(3,4,5-trimethylpyrazol-1-yl)butanethioamide |
| SMILES | Cc1nn(CCC(C)(C)C(N)=S)c(C)c1C |
| InChI | InChI=1S/C12H21N3S/c1-8-9(2)14-15(10(8)3)7-6-12(4,5)11(13)16/h6-7H2,1-5H3,(H2,13,16) |
| InChIKey | SCVLBQPYJDFGSN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|