About N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine
N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine (PubChem CID 60982104) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine |
| PubChem CID | 60982104 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine |
| SMILES | Cc1nn(CCN(C)C)c(C)c1C |
| InChI | InChI=1S/C10H19N3/c1-8-9(2)11-13(10(8)3)7-6-12(4)5/h6-7H2,1-5H3 |
| InChIKey | OSSVQCQBAZSWBT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine?
The IUPAC name of N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine (CID 60982104) is N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine.
What is the SMILES notation for N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine?
The canonical SMILES for N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine is Cc1nn(CCN(C)C)c(C)c1C.
What is the InChIKey of N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine?
The InChIKey is OSSVQCQBAZSWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-8-9(2)11-13(10(8)3)7-6-12(4)5/h6-7H2,1-5H3.
What are the key properties of N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine?
N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine has a molecular weight of 181.28 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(3,4,5-trimethylpyrazol-1-yl)ethanamine is sourced from PubChem (CID 60982104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).