C8H14IN3 — CID 170122692
2-(4-iodo-5-methylpyrazol-1-yl)-N,N-dimethylethanamine (PubChem CID 170122692) has the molecular formula C8H14IN3 and a molecular weight of 279.12 g/mol. Its IUPAC name is 2-(4-iodo-5-methylpyrazol-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(4-iodo-5-methylpyrazol-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 170122692 |
| Molecular Formula | C8H14IN3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-(4-iodo-5-methylpyrazol-1-yl)-N,N-dimethylethanamine |
| SMILES | Cc1c(I)cnn1CCN(C)C |
| InChI | InChI=1S/C8H14IN3/c1-7-8(9)6-10-12(7)5-4-11(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | YRVOTHVXOIYERD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|