C12H22ClN3O — CID 114665514
2-[5-(3-chloro-2-methylpropyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 114665514) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 2-[5-(3-chloro-2-methylpropyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[5-(3-chloro-2-methylpropyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 114665514 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-[5-(3-chloro-2-methylpropyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | COc1cnn(CCN(C)C)c1CC(C)CCl |
| InChI | InChI=1S/C12H22ClN3O/c1-10(8-13)7-11-12(17-4)9-14-16(11)6-5-15(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | RZPFUFHWYSBKCP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|