C15H28ClN3O — CID 114665311
2-[5-(3-chloro-4,4-dimethylpentyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 114665311) has the molecular formula C15H28ClN3O and a molecular weight of 301.86 g/mol. Its IUPAC name is 2-[5-(3-chloro-4,4-dimethylpentyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[5-(3-chloro-4,4-dimethylpentyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 114665311 |
| Molecular Formula | C15H28ClN3O |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-[5-(3-chloro-4,4-dimethylpentyl)-4-methoxypyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | COc1cnn(CCN(C)C)c1CCC(Cl)C(C)(C)C |
| InChI | InChI=1S/C15H28ClN3O/c1-15(2,3)14(16)8-7-12-13(20-6)11-17-19(12)10-9-18(4)5/h11,14H,7-10H2,1-6H3 |
| InChIKey | KHTLMJNXEWYRKB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|