C13H17BrCl2 — CID 66048495
2-[2-(bromomethyl)-2-ethylbutyl]-1,3-dichlorobenzene (PubChem CID 66048495) has the molecular formula C13H17BrCl2 and a molecular weight of 324.09 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-ethylbutyl]-1,3-dichlorobenzene.
| Compound Name | 2-[2-(bromomethyl)-2-ethylbutyl]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 66048495 |
| Molecular Formula | C13H17BrCl2 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-[2-(bromomethyl)-2-ethylbutyl]-1,3-dichlorobenzene |
| SMILES | CCC(CC)(CBr)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17BrCl2/c1-3-13(4-2,9-14)8-10-11(15)6-5-7-12(10)16/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | XSUGMFQXLZWFTC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|