C9H12ClFN2 — CID 102623253
1-(2-chloro-5-fluorophenyl)propan-2-ylhydrazine (PubChem CID 102623253) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)propan-2-ylhydrazine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)propan-2-ylhydrazine |
|---|---|
| PubChem CID | 102623253 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)propan-2-ylhydrazine |
| SMILES | CC(Cc1cc(F)ccc1Cl)NN |
| InChI | InChI=1S/C9H12ClFN2/c1-6(13-12)4-7-5-8(11)2-3-9(7)10/h2-3,5-6,13H,4,12H2,1H3 |
| InChIKey | JMDVKMXEQZCGRO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|