C11H16ClFN2S — CID 102623322
[1-(2-chloro-5-fluorophenyl)-3-ethylsulfanylpropan-2-yl]hydrazine (PubChem CID 102623322) has the molecular formula C11H16ClFN2S and a molecular weight of 262.78 g/mol. Its IUPAC name is [1-(2-chloro-5-fluorophenyl)-3-ethylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-5-fluorophenyl)-3-ethylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 102623322 |
| Molecular Formula | C11H16ClFN2S |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [1-(2-chloro-5-fluorophenyl)-3-ethylsulfanylpropan-2-yl]hydrazine |
| SMILES | CCSCC(Cc1cc(F)ccc1Cl)NN |
| InChI | InChI=1S/C11H16ClFN2S/c1-2-16-7-10(15-14)6-8-5-9(13)3-4-11(8)12/h3-5,10,15H,2,6-7,14H2,1H3 |
| InChIKey | KTLPMFTWLGUERP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|