C15H22N4O — CID 102624101
2-[4-amino-3-(cyanomethyl)-N-propylanilino]-N,N-dimethylacetamide (PubChem CID 102624101) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[4-amino-3-(cyanomethyl)-N-propylanilino]-N,N-dimethylacetamide.
| Compound Name | 2-[4-amino-3-(cyanomethyl)-N-propylanilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102624101 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-[4-amino-3-(cyanomethyl)-N-propylanilino]-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)c1ccc(N)c(CC#N)c1 |
| InChI | InChI=1S/C15H22N4O/c1-4-9-19(11-15(20)18(2)3)13-5-6-14(17)12(10-13)7-8-16/h5-6,10H,4,7,9,11,17H2,1-3H3 |
| InChIKey | YYEDJBQVDLSKAR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|