C17H29N3O — CID 62129619
2-[4-(ethylaminomethyl)-3-methyl-N-propylanilino]-N,N-dimethylacetamide (PubChem CID 62129619) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[4-(ethylaminomethyl)-3-methyl-N-propylanilino]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(ethylaminomethyl)-3-methyl-N-propylanilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 62129619 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-[4-(ethylaminomethyl)-3-methyl-N-propylanilino]-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)c1ccc(CNCC)c(C)c1 |
| InChI | InChI=1S/C17H29N3O/c1-6-10-20(13-17(21)19(4)5)16-9-8-15(12-18-7-2)14(3)11-16/h8-9,11,18H,6-7,10,12-13H2,1-5H3 |
| InChIKey | MYBOTXFUXJXGPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|