C12H17NO2 — CID 10262437
benzyl N,N-diethylcarbamate (PubChem CID 10262437) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is benzyl N,N-diethylcarbamate.
| Compound Name | benzyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 10262437 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | benzyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-3-13(4-2)12(14)15-10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | AYEFZRJHKJIURZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |