C15H18N4S — CID 102624625
2-[2-amino-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]phenyl]acetonitrile (PubChem CID 102624625) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-[2-amino-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624625 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[2-amino-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]phenyl]acetonitrile |
| SMILES | CCc1cnc(C(C)Nc2ccc(N)c(CC#N)c2)s1 |
| InChI | InChI=1S/C15H18N4S/c1-3-13-9-18-15(20-13)10(2)19-12-4-5-14(17)11(8-12)6-7-16/h4-5,8-10,19H,3,6,17H2,1-2H3 |
| InChIKey | KXAMFNGRRKTOGJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|