C11H10N4S3 — CID 102625100
2-[2-amino-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]acetonitrile (PubChem CID 102625100) has the molecular formula C11H10N4S3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 2-[2-amino-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 102625100 |
| Molecular Formula | C11H10N4S3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-[2-amino-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]acetonitrile |
| SMILES | CSc1nnc(Sc2ccc(N)c(CC#N)c2)s1 |
| InChI | InChI=1S/C11H10N4S3/c1-16-10-14-15-11(18-10)17-8-2-3-9(13)7(6-8)4-5-12/h2-3,6H,4,13H2,1H3 |
| InChIKey | NLURCUUZURQBNC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|