C13H17N5 — CID 102625295
1-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboximidamide (PubChem CID 102625295) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboximidamide.
| Compound Name | 1-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 102625295 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCN(c2cccc3nccn23)CC1 |
| InChI | InChI=1S/C13H17N5/c14-13(15)10-4-7-17(8-5-10)12-3-1-2-11-16-6-9-18(11)12/h1-3,6,9-10H,4-5,7-8H2,(H3,14,15) |
| InChIKey | QNRZHRKHBGPULM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|