C13H18N2O2S — CID 102626023
methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate (PubChem CID 102626023) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate.
| Compound Name | methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate |
|---|---|
| PubChem CID | 102626023 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate |
| SMILES | CCCCCCc1cn2cc(C(=O)OC)sc2n1 |
| InChI | InChI=1S/C13H18N2O2S/c1-3-4-5-6-7-10-8-15-9-11(12(16)17-2)18-13(15)14-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | FBSSACZQOOHVFD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|