About methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate
methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate (PubChem CID 102626023) has the molecular formula C13H18N2O2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate |
| PubChem CID | 102626023 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate |
| SMILES | CCCCCCc1cn2cc(C(=O)OC)sc2n1 |
| InChI | InChI=1S/C13H18N2O2S/c1-3-4-5-6-7-10-8-15-9-11(12(16)17-2)18-13(15)14-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | FBSSACZQOOHVFD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
The IUPAC name of methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate (CID 102626023) is methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate.
What is the SMILES notation for methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
The canonical SMILES for methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate is CCCCCCc1cn2cc(C(=O)OC)sc2n1.
What is the InChIKey of methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
The InChIKey is FBSSACZQOOHVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2S/c1-3-4-5-6-7-10-8-15-9-11(12(16)17-2)18-13(15)14-10/h8-9H,3-7H2,1-2H3.
What are the key properties of methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate has a molecular weight of 266.37 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-hexylimidazo[2,1-b][1,3]thiazole-2-carboxylate is sourced from PubChem (CID 102626023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).