C14H16N2O — CID 102626384
cyclohexyl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone (PubChem CID 102626384) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is cyclohexyl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone.
| Compound Name | cyclohexyl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 102626384 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | cyclohexyl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccncc12)C1CCCCC1 |
| InChI | InChI=1S/C14H16N2O/c17-14(10-4-2-1-3-5-10)12-9-16-13-6-7-15-8-11(12)13/h6-10,16H,1-5H2 |
| InChIKey | MRBWPBHKOSDGAS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |