C12H12N2O2 — CID 102626691
oxolan-3-yl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone (PubChem CID 102626691) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is oxolan-3-yl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone.
| Compound Name | oxolan-3-yl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 102626691 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | oxolan-3-yl(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccncc12)C1CCOC1 |
| InChI | InChI=1S/C12H12N2O2/c15-12(8-2-4-16-7-8)10-6-14-11-1-3-13-5-9(10)11/h1,3,5-6,8,14H,2,4,7H2 |
| InChIKey | LISUQZLQTWKXMD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |