C16H14N2O3 — CID 102626742
(2,6-dimethoxyphenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone (PubChem CID 102626742) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone.
| Compound Name | (2,6-dimethoxyphenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 102626742 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)c1c[nH]c2ccncc12 |
| InChI | InChI=1S/C16H14N2O3/c1-20-13-4-3-5-14(21-2)15(13)16(19)11-9-18-12-6-7-17-8-10(11)12/h3-9,18H,1-2H3 |
| InChIKey | ZDHATYQKYUSBSF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |