C14H8FIN2O — CID 114029204
(4-fluoro-2-iodophenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone (PubChem CID 114029204) has the molecular formula C14H8FIN2O and a molecular weight of 366.13 g/mol. Its IUPAC name is (4-fluoro-2-iodophenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone.
| Compound Name | (4-fluoro-2-iodophenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 114029204 |
| Molecular Formula | C14H8FIN2O |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | (4-fluoro-2-iodophenyl)-(1H-pyrrolo[3,2-c]pyridin-3-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1I)c1c[nH]c2ccncc12 |
| InChI | InChI=1S/C14H8FIN2O/c15-8-1-2-9(12(16)5-8)14(19)11-7-18-13-3-4-17-6-10(11)13/h1-7,18H |
| InChIKey | CSQQEPSBURWPFE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|