C14H28N2 — CID 102627979
2,3,3-trimethyl-4-[[methyl(prop-2-enyl)amino]methyl]cyclohexan-1-amine (PubChem CID 102627979) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-[[methyl(prop-2-enyl)amino]methyl]cyclohexan-1-amine.
| Compound Name | 2,3,3-trimethyl-4-[[methyl(prop-2-enyl)amino]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 102627979 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2,3,3-trimethyl-4-[[methyl(prop-2-enyl)amino]methyl]cyclohexan-1-amine |
| SMILES | C=CCN(C)CC1CCC(N)C(C)C1(C)C |
| InChI | InChI=1S/C14H28N2/c1-6-9-16(5)10-12-7-8-13(15)11(2)14(12,3)4/h6,11-13H,1,7-10,15H2,2-5H3 |
| InChIKey | QVMOGGZCEUDKNJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|