C15H28N2 — CID 55093744
2-[[bis(prop-2-enyl)amino]methyl]-4-ethylcyclohexan-1-amine (PubChem CID 55093744) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 2-[[bis(prop-2-enyl)amino]methyl]-4-ethylcyclohexan-1-amine.
| Compound Name | 2-[[bis(prop-2-enyl)amino]methyl]-4-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 55093744 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 2-[[bis(prop-2-enyl)amino]methyl]-4-ethylcyclohexan-1-amine |
| SMILES | C=CCN(CC=C)CC1CC(CC)CCC1N |
| InChI | InChI=1S/C15H28N2/c1-4-9-17(10-5-2)12-14-11-13(6-3)7-8-15(14)16/h4-5,13-15H,1-2,6-12,16H2,3H3 |
| InChIKey | GTAJNRDITHWVLH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|