C11H24N2 — CID 43263387
2-N,4-diethyl-2-N-methylcyclohexane-1,2-diamine (PubChem CID 43263387) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2-N,4-diethyl-2-N-methylcyclohexane-1,2-diamine.
| Compound Name | 2-N,4-diethyl-2-N-methylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 43263387 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2-N,4-diethyl-2-N-methylcyclohexane-1,2-diamine |
| SMILES | CCC1CCC(N)C(N(C)CC)C1 |
| InChI | InChI=1S/C11H24N2/c1-4-9-6-7-10(12)11(8-9)13(3)5-2/h9-11H,4-8,12H2,1-3H3 |
| InChIKey | XZSSSOBVOXNNML-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |