C12H21N3O — CID 102628656
4-amino-N-(cyanomethyl)-2,2,3-trimethylcyclohexane-1-carboxamide (PubChem CID 102628656) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-amino-N-(cyanomethyl)-2,2,3-trimethylcyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(cyanomethyl)-2,2,3-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102628656 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-amino-N-(cyanomethyl)-2,2,3-trimethylcyclohexane-1-carboxamide |
| SMILES | CC1C(N)CCC(C(=O)NCC#N)C1(C)C |
| InChI | InChI=1S/C12H21N3O/c1-8-10(14)5-4-9(12(8,2)3)11(16)15-7-6-13/h8-10H,4-5,7,14H2,1-3H3,(H,15,16) |
| InChIKey | ROFDHNAGRWCCOP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|