C11H22N2O2 — CID 102628940
4-amino-N-methoxy-2,2,3-trimethylcyclohexane-1-carboxamide (PubChem CID 102628940) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-amino-N-methoxy-2,2,3-trimethylcyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-methoxy-2,2,3-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102628940 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-amino-N-methoxy-2,2,3-trimethylcyclohexane-1-carboxamide |
| SMILES | CONC(=O)C1CCC(N)C(C)C1(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-7-9(12)6-5-8(11(7,2)3)10(14)13-15-4/h7-9H,5-6,12H2,1-4H3,(H,13,14) |
| InChIKey | HOJLYSGUUMELGG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|