C14H25F3N2O — CID 102629120
4-amino-2,2,3-trimethyl-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide (PubChem CID 102629120) has the molecular formula C14H25F3N2O and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-amino-2,2,3-trimethyl-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-2,2,3-trimethyl-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102629120 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-amino-2,2,3-trimethyl-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide |
| SMILES | CC1C(N)CCC(C(=O)NCCCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C14H25F3N2O/c1-9-11(18)6-5-10(13(9,2)3)12(20)19-8-4-7-14(15,16)17/h9-11H,4-8,18H2,1-3H3,(H,19,20) |
| InChIKey | QXGNWFLPJAZZMB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|