C11H10N6O2S2 — CID 102630109
2-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide (PubChem CID 102630109) has the molecular formula C11H10N6O2S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is 2-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide.
| Compound Name | 2-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide |
|---|---|
| PubChem CID | 102630109 |
| Molecular Formula | C11H10N6O2S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide |
| SMILES | NCc1nnc(SCC(=O)Nc2cccc3c2N=S=N3)o1 |
| InChI | InChI=1S/C11H10N6O2S2/c12-4-9-14-15-11(19-9)20-5-8(18)13-6-2-1-3-7-10(6)17-21-16-7/h1-3H,4-5,12H2,(H,13,18) |
| InChIKey | ZXCQYVFXHUFTOO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |