C13H22O3 — CID 10263110
methyl (2S,4aR,8R,8aS)-8-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-2-carboxylate (PubChem CID 10263110) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is methyl (2S,4aR,8R,8aS)-8-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-2-carboxylate.
| Compound Name | methyl (2S,4aR,8R,8aS)-8-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10263110 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | methyl (2S,4aR,8R,8aS)-8-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H]2CCC[C@@H](O)[C@@]2(C)C1 |
| InChI | InChI=1S/C13H22O3/c1-13-8-9(12(15)16-2)6-7-10(13)4-3-5-11(13)14/h9-11,14H,3-8H2,1-2H3/t9-,10+,11+,13-/m0/s1 |
| InChIKey | QCWMXAHMOLOEOB-WGBDABJCSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |