C16H25N — CID 10263314
(2R)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10263314) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (2R)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10263314 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (2R)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)[C@@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H25N/c1-3-11-17(12-4-2)16-10-9-14-7-5-6-8-15(14)13-16/h5-8,16H,3-4,9-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | IMMAROBNUIRASX-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |