About 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine
3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine (PubChem CID 10333104) has the molecular formula C19H23N
and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 10333104 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C19H23N/c1-20(2)13-7-12-19-17-10-5-3-8-15(17)14-16-9-4-6-11-18(16)19/h3-6,8-11,19H,7,12-14H2,1-2H3 |
| InChIKey | LRTHKJMSTYBFFO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine (CID 10333104) is 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine is CN(C)CCCC1c2ccccc2Cc2ccccc21.
What is the InChIKey of 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is LRTHKJMSTYBFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N/c1-20(2)13-7-12-19-17-10-5-3-8-15(17)14-16-9-4-6-11-18(16)19/h3-6,8-11,19H,7,12-14H2,1-2H3.
What are the key properties of 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine?
3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 265.40 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9,10-dihydroanthracen-9-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 10333104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).