About N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine
N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine (PubChem CID 102633268) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine |
| PubChem CID | 102633268 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine |
| SMILES | CNC1CCCCC1OCc1cc(C)no1 |
| InChI | InChI=1S/C12H20N2O2/c1-9-7-10(16-14-9)8-15-12-6-4-3-5-11(12)13-2/h7,11-13H,3-6,8H2,1-2H3 |
| InChIKey | HRLWFCBJSVUWBL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine?
The IUPAC name of N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine (CID 102633268) is N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine.
What is the SMILES notation for N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine?
The canonical SMILES for N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine is CNC1CCCCC1OCc1cc(C)no1.
What is the InChIKey of N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine?
The InChIKey is HRLWFCBJSVUWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-9-7-10(16-14-9)8-15-12-6-4-3-5-11(12)13-2/h7,11-13H,3-6,8H2,1-2H3.
What are the key properties of N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine?
N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine has a molecular weight of 224.30 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]cyclohexan-1-amine is sourced from PubChem (CID 102633268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).