C10H16N2O — CID 83846520
3-methyl-5-(piperidin-2-ylmethyl)-1,2-oxazole (PubChem CID 83846520) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-methyl-5-(piperidin-2-ylmethyl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(piperidin-2-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 83846520 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-methyl-5-(piperidin-2-ylmethyl)-1,2-oxazole |
| SMILES | Cc1cc(CC2CCCCN2)on1 |
| InChI | InChI=1S/C10H16N2O/c1-8-6-10(13-12-8)7-9-4-2-3-5-11-9/h6,9,11H,2-5,7H2,1H3 |
| InChIKey | WTXGWJKGSJULMH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |