C8H11ClN2O — CID 84719045
5-chloro-3-(pyrrolidin-2-ylmethyl)-1,2-oxazole (PubChem CID 84719045) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 5-chloro-3-(pyrrolidin-2-ylmethyl)-1,2-oxazole.
| Compound Name | 5-chloro-3-(pyrrolidin-2-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 84719045 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 5-chloro-3-(pyrrolidin-2-ylmethyl)-1,2-oxazole |
| SMILES | Clc1cc(CC2CCCN2)no1 |
| InChI | InChI=1S/C8H11ClN2O/c9-8-5-7(11-12-8)4-6-2-1-3-10-6/h5-6,10H,1-4H2 |
| InChIKey | KMNFKMVCAUELRY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |