C8H12N2O — CID 82595027
3-(pyrrolidin-2-ylmethyl)-1,2-oxazole (PubChem CID 82595027) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-(pyrrolidin-2-ylmethyl)-1,2-oxazole.
| Compound Name | 3-(pyrrolidin-2-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 82595027 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-(pyrrolidin-2-ylmethyl)-1,2-oxazole |
| SMILES | c1cc(CC2CCCN2)no1 |
| InChI | InChI=1S/C8H12N2O/c1-2-7(9-4-1)6-8-3-5-11-10-8/h3,5,7,9H,1-2,4,6H2 |
| InChIKey | HDRSZMMOISJYLE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |