C11H19N3O3S — CID 81178466
N-(1,2-oxazol-3-ylmethyl)-2-piperidin-2-ylethanesulfonamide (PubChem CID 81178466) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-2-piperidin-2-ylethanesulfonamide.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-2-piperidin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 81178466 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-2-piperidin-2-ylethanesulfonamide |
| SMILES | O=S(=O)(CCC1CCCCN1)NCc1ccon1 |
| InChI | InChI=1S/C11H19N3O3S/c15-18(16,13-9-11-4-7-17-14-11)8-5-10-3-1-2-6-12-10/h4,7,10,12-13H,1-3,5-6,8-9H2 |
| InChIKey | ZVVHYHAVSMYRCU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |